CAS 1499532-43-2 is the registry number for Sodium 2,5-difluoro-4-methylbenzene-1-sulfinate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Sodium 2,5-difluoro-4-methylbenzenesulfinate (CAS 1499532-43-2) is a chemical compound with the molecular formula C7H5F2NaO2S and a molecular weight of 214.17 g/mol. IUPAC name: sodium 2,5-difluoro-4-methylbenzenesulfinate. InChIKey: LZQFDJZQUBOMSS-UHFFFAOYSA-M.
| Molecular formula | C7H5F2NaO2S |
|---|---|
| Molecular weight | 214.17 g/mol |
| IUPAC name | sodium 2,5-difluoro-4-methylbenzenesulfinate |
| InChIKey | LZQFDJZQUBOMSS-UHFFFAOYSA-M |
| SMILES | CC1=CC(=C(C=C1F)S(=O)[O-])F.[Na+] |
Computed by PubChem (NCBI)