CAS 149981-21-5 is the registry number for 3,7-Dimethyl-8-(p-sulfonamidophenyl)xanthine. Offered by: TRC. Available pack sizes: 100mg, 25mg, 50mg.
4-(3,7-dimethyl-2,6-dioxopurin-8-yl)benzenesulfonamide (CAS 149981-21-5) is a chemical compound with the molecular formula C13H13N5O4S and a molecular weight of 335.34 g/mol. IUPAC name: 4-(3,7-dimethyl-2,6-dioxopurin-8-yl)benzenesulfonamide. InChIKey: DDFVXPNYCNTGTD-UHFFFAOYSA-N.
| Molecular formula | C13H13N5O4S |
|---|---|
| Molecular weight | 335.34 g/mol |
| IUPAC name | 4-(3,7-dimethyl-2,6-dioxopurin-8-yl)benzenesulfonamide |
| InChIKey | DDFVXPNYCNTGTD-UHFFFAOYSA-N |
| SMILES | CN1C2=C(N=C1C3=CC=C(C=C3)S(=O)(=O)N)N(C(=O)NC2=O)C |
Computed by PubChem (NCBI)