Products 149981-25-9

CAS 149981-25-9 is the registry number for 1-Allyl-3,7-dimethyl-8-p-sulfophenylxanthine Sodium Salt. Offered by: TRC. Available pack sizes: 10mg, 1mg, 2,5mg.

Structural formula: {0} (CAS {1})

4-(3,7-dimethyl-2,6-dioxo-1-prop-2-enylpurin-8-yl)benzenesulfonic acid (CAS 149981-25-9) is a chemical compound with the molecular formula C16H16N4O5S and a molecular weight of 376.4 g/mol. IUPAC name: 4-(3,7-dimethyl-2,6-dioxo-1-prop-2-enylpurin-8-yl)benzenesulfonic acid. InChIKey: CDMZOKMMANFJMU-UHFFFAOYSA-N.

Identity
Molecular formulaC16H16N4O5S
Molecular weight376.4 g/mol
IUPAC name4-(3,7-dimethyl-2,6-dioxo-1-prop-2-enylpurin-8-yl)benzenesulfonic acid
InChIKeyCDMZOKMMANFJMU-UHFFFAOYSA-N
SMILESCN1C2=C(N=C1C3=CC=C(C=C3)S(=O)(=O)O)N(C(=O)N(C2=O)CC=C)C

Computed by PubChem (NCBI)