CAS 1500076-79-8 is the registry number for (2R)-2-Deoxy-2-fluoro-2-methyl-beta-D-erythro-pentofuranosyl Chloride 3,5-Dibenzoate. Offered by: TRC. Available pack sizes: 25mg.
[(2R,5S)-3-benzoyloxy-5-chloro-4-fluoro-4-methyloxolan-2-yl]methyl benzoate (CAS 1500076-79-8) is a chemical compound with the molecular formula C20H18ClFO5 and a molecular weight of 392.8 g/mol. IUPAC name: [(2R,5S)-3-benzoyloxy-5-chloro-4-fluoro-4-methyloxolan-2-yl]methyl benzoate. InChIKey: VLPZJFQKABILMS-HSHZPNLASA-N.
| Molecular formula | C20H18ClFO5 |
|---|---|
| Molecular weight | 392.8 g/mol |
| IUPAC name | [(2R,5S)-3-benzoyloxy-5-chloro-4-fluoro-4-methyloxolan-2-yl]methyl benzoate |
| InChIKey | VLPZJFQKABILMS-HSHZPNLASA-N |
| SMILES | CC1([C@@H](O[C@@H](C1OC(=O)C2=CC=CC=C2)COC(=O)C3=CC=CC=C3)Cl)F |
Computed by PubChem (NCBI)