CAS 1621160-31-3 appears in our catalog under these names: Sofosbuvir Impurity 8, Sofosbuvir Impurity 85, ((2R,3R,4R)-3-(Benzoyloxy)-5-chloro-4-fluoro-4-methyltetrahydrofuran-2-yl)methyl benzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3R,4R)-3-benzoyloxy-5-chloro-4-fluoro-4-methyloxolan-2-yl]methyl benzoate (CAS 1621160-31-3) is a chemical compound with the molecular formula C20H18ClFO5 and a molecular weight of 392.8 g/mol. IUPAC name: [(2R,3R,4R)-3-benzoyloxy-5-chloro-4-fluoro-4-methyloxolan-2-yl]methyl benzoate. InChIKey: VLPZJFQKABILMS-ZSVOKBKLSA-N.
| Molecular formula | C20H18ClFO5 |
|---|---|
| Molecular weight | 392.8 g/mol |
| IUPAC name | [(2R,3R,4R)-3-benzoyloxy-5-chloro-4-fluoro-4-methyloxolan-2-yl]methyl benzoate |
| InChIKey | VLPZJFQKABILMS-ZSVOKBKLSA-N |
| SMILES | C[C@]1([C@@H]([C@H](OC1Cl)COC(=O)C2=CC=CC=C2)OC(=O)C3=CC=CC=C3)F |
Computed by PubChem (NCBI)