CAS 150024-49-0 appears in our catalog under these names: (1S)-2,2'-Dibromo-1,1'-binaphthalene 98% 99%ee, (1S)-2,2'-Dibromo-1,1'-binaphthalene, 98% 99%ee, 98% 99%ee, (S)​-2,​2'-Dibromo-1,​1'-binaphthalene, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.
2-bromo-1-(2-bromonaphthalen-1-yl)naphthalene (CAS 150024-49-0) is a chemical compound with the molecular formula C20H12Br2 and a molecular weight of 412.1 g/mol. IUPAC name: 2-bromo-1-(2-bromonaphthalen-1-yl)naphthalene. InChIKey: IJUDEFZBMMRSNM-UHFFFAOYSA-N.
| Molecular formula | C20H12Br2 |
|---|---|
| Molecular weight | 412.1 g/mol |
| IUPAC name | 2-bromo-1-(2-bromonaphthalen-1-yl)naphthalene |
| InChIKey | IJUDEFZBMMRSNM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2C3=C(C=CC4=CC=CC=C43)Br)Br |
Computed by PubChem (NCBI)