CAS 150025-01-7 appears in our catalog under these names: H-D-Pen(trt)-oh, 95%, (S)-2-Amino-3-methyl-3-(tritylthio)butanoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
(2S)-2-amino-3-methyl-3-tritylsulfanylbutanoic acid (CAS 150025-01-7) is a chemical compound with the molecular formula C24H25NO2S and a molecular weight of 391.5 g/mol. IUPAC name: (2S)-2-amino-3-methyl-3-tritylsulfanylbutanoic acid. InChIKey: XSOLHQWRHYIXOC-NRFANRHFSA-N.
| Molecular formula | C24H25NO2S |
|---|---|
| Molecular weight | 391.5 g/mol |
| IUPAC name | (2S)-2-amino-3-methyl-3-tritylsulfanylbutanoic acid |
| InChIKey | XSOLHQWRHYIXOC-NRFANRHFSA-N |
| SMILES | CC(C)([C@H](C(=O)O)N)SC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)