CAS 150026-73-6 is the registry number for Montelukast Impurity 40. Offered by: Chemat Brand. Available pack sizes: on request.
1-[2-[(3R)-3-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-hydroxypropyl]phenyl]ethanone (CAS 150026-73-6) is a chemical compound with the molecular formula C28H24ClNO2 and a molecular weight of 441.9 g/mol. IUPAC name: 1-[2-[(3R)-3-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-hydroxypropyl]phenyl]ethanone. InChIKey: NZSTWJFMJOWIJY-LZZUIANGSA-N.
| Molecular formula | C28H24ClNO2 |
|---|---|
| Molecular weight | 441.9 g/mol |
| IUPAC name | 1-[2-[(3R)-3-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-hydroxypropyl]phenyl]ethanone |
| InChIKey | NZSTWJFMJOWIJY-LZZUIANGSA-N |
| SMILES | CC(=O)C1=CC=CC=C1CC[C@H](C2=CC=CC(=C2)/C=C/C3=NC4=C(C=CC(=C4)Cl)C=C3)O |
Computed by PubChem (NCBI)