Products 1500358-48-4

CAS 1500358-48-4 is the registry number for Ethyl 5-iodo-1,3-thiazole-2-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Ethyl 5-iodo-1,3-thiazole-2-carboxylate (CAS 1500358-48-4) is a chemical compound with the molecular formula C6H6INO2S and a molecular weight of 283.09 g/mol. IUPAC name: ethyl 5-iodo-1,3-thiazole-2-carboxylate. InChIKey: JMMYMFAREZBJOF-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6INO2S
Molecular weight283.09 g/mol
IUPAC nameethyl 5-iodo-1,3-thiazole-2-carboxylate
InChIKeyJMMYMFAREZBJOF-UHFFFAOYSA-N
SMILESCCOC(=O)C1=NC=C(S1)I

Computed by PubChem (NCBI)