CAS 150057-49-1 is the registry number for 1954U89. Offered by: MedChemExpress. Available pack sizes: Get quote.
8-methyl-7-pentan-3-ylpyrrolo[3,2-f]quinazoline-1,3-diamine (CAS 150057-49-1) is a chemical compound with the molecular formula C16H21N5 and a molecular weight of 283.37 g/mol. IUPAC name: 8-methyl-7-pentan-3-ylpyrrolo[3,2-f]quinazoline-1,3-diamine. InChIKey: YBHNZQJIFKDDHM-UHFFFAOYSA-N.
| Molecular formula | C16H21N5 |
|---|---|
| Molecular weight | 283.37 g/mol |
| IUPAC name | 8-methyl-7-pentan-3-ylpyrrolo[3,2-f]quinazoline-1,3-diamine |
| InChIKey | YBHNZQJIFKDDHM-UHFFFAOYSA-N |
| SMILES | CCC(CC)N1C(=CC2=C1C=CC3=C2C(=NC(=N3)N)N)C |
Computed by PubChem (NCBI)