Products 1501092-38-1
CAS 1501092-38-1 is the registry number for 2-((2-Amino-3-methylphenyl)sulfanyl)-N,N-dimethylacetamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(2-amino-3-methylphenyl)sulfanyl-N,N-dimethylacetamide (CAS 1501092-38-1) is a chemical compound with the molecular formula C11H16N2OS and a molecular weight of 224.32 g/mol. IUPAC name: 2-(2-amino-3-methylphenyl)sulfanyl-N,N-dimethylacetamide. InChIKey: PNCJLAJOMYPQNA-UHFFFAOYSA-N.
| Molecular formula | C11H16N2OS |
|---|---|
| Molecular weight | 224.32 g/mol |
| IUPAC name | 2-(2-amino-3-methylphenyl)sulfanyl-N,N-dimethylacetamide |
| InChIKey | PNCJLAJOMYPQNA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)SCC(=O)N(C)C)N |
Computed by PubChem (NCBI)