Products 1501097-42-2

CAS 1501097-42-2 is the registry number for Ethyl 3-amino-3,4-dimethylpentanoate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Ethyl 3-amino-3,4-dimethylpentanoate (CAS 1501097-42-2) is a chemical compound with the molecular formula C9H19NO2 and a molecular weight of 173.25 g/mol. IUPAC name: ethyl 3-amino-3,4-dimethylpentanoate. InChIKey: XTWFQHYGHRSJSA-UHFFFAOYSA-N.

Identity
Molecular formulaC9H19NO2
Molecular weight173.25 g/mol
IUPAC nameethyl 3-amino-3,4-dimethylpentanoate
InChIKeyXTWFQHYGHRSJSA-UHFFFAOYSA-N
SMILESCCOC(=O)CC(C)(C(C)C)N

Computed by PubChem (NCBI)