CAS 150152-65-1 appears in our catalog under these names: BDP TR NHS ester, BDP TR NHS ester, 95%, Bdp tr nhs ester, Bdp tr nhs ester 95%, BDP TR NHS ester, 95%, 95%. Offered by: GLPBio, Lumiprobe, TargetMol, Ambeed, Chemat. Available pack sizes: 1mg, 5mg, 25mg, 50mg, 100mg, 10mg.
(2,5-dioxopyrrolidin-1-yl) 2-[4-(2,2-difluoro-12-thiophen-2-yl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-4-yl)phenoxy]acetate (CAS 150152-65-1) is a chemical compound with the molecular formula C25H18BF2N3O5S and a molecular weight of 521.3 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 2-[4-(2,2-difluoro-12-thiophen-2-yl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-4-yl)phenoxy]acetate. InChIKey: BQEJRWFJZINFCP-UHFFFAOYSA-N.
| Molecular formula | C25H18BF2N3O5S |
|---|---|
| Molecular weight | 521.3 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 2-[4-(2,2-difluoro-12-thiophen-2-yl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-4-yl)phenoxy]acetate |
| InChIKey | BQEJRWFJZINFCP-UHFFFAOYSA-N |
| SMILES | [B-]1(N2C(=CC=C2C3=CC=CS3)C=C4[N+]1=C(C=C4)C5=CC=C(C=C5)OCC(=O)ON6C(=O)CCC6=O)(F)F |
Computed by PubChem (NCBI)