Products 15016-43-0

CAS 15016-43-0 appears in our catalog under these names: 3–Vinylphenylboronic acid, 3-Vinylphenylboronic Acid (contains varying amounts of Anhydride), (3-Vinylphenyl)boronic acid 95%, (3-Vinylphenyl)boronic acid, 95%. Offered by: GLPBio, TCI, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g, 100g.

Structural formula: {0} (CAS {1})

(3-ethenylphenyl)boronic acid (CAS 15016-43-0) is a chemical compound with the molecular formula C8H9BO2 and a molecular weight of 147.97 g/mol. IUPAC name: (3-ethenylphenyl)boronic acid. InChIKey: SYBQEKBVWDPVJM-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9BO2
Molecular weight147.97 g/mol
IUPAC name(3-ethenylphenyl)boronic acid
InChIKeySYBQEKBVWDPVJM-UHFFFAOYSA-N
SMILESB(C1=CC(=CC=C1)C=C)(O)O

Computed by PubChem (NCBI)