Products 1501657-28-8
CAS 1501657-28-8 is the registry number for 1-(2-bromo-6-fluoro-3-methoxyphenyl)-2-methylpropan-1-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-(2-bromo-6-fluoro-3-methoxyphenyl)-2-methylpropan-1-ol (CAS 1501657-28-8) is a chemical compound with the molecular formula C11H14BrFO2 and a molecular weight of 277.13 g/mol. IUPAC name: 1-(2-bromo-6-fluoro-3-methoxyphenyl)-2-methylpropan-1-ol. InChIKey: XZEOXYOCJRDGBF-UHFFFAOYSA-N.
| Molecular formula | C11H14BrFO2 |
|---|---|
| Molecular weight | 277.13 g/mol |
| IUPAC name | 1-(2-bromo-6-fluoro-3-methoxyphenyl)-2-methylpropan-1-ol |
| InChIKey | XZEOXYOCJRDGBF-UHFFFAOYSA-N |
| SMILES | CC(C)C(C1=C(C=CC(=C1Br)OC)F)O |
Computed by PubChem (NCBI)