CAS 150178-33-9 appears in our catalog under these names: 3-Methylbutan-1-aminium tetrafluoroborate, 98%, Poly((9,9-dioctyl-2,7-divinylenefluorenylene)-alt-(4,4'-biphenylene)). Offered by: Chemat Brand, Lumtec. Available pack sizes: on request.
3-methylbutylazanium tetrafluoroborate (CAS 150178-33-9) is a chemical compound with the molecular formula C5H14BF4N and a molecular weight of 174.98 g/mol. IUPAC name: 3-methylbutylazanium tetrafluoroborate. InChIKey: BUFIJLSVCRHWHL-UHFFFAOYSA-O.
| Molecular formula | C5H14BF4N |
|---|---|
| Molecular weight | 174.98 g/mol |
| IUPAC name | 3-methylbutylazanium tetrafluoroborate |
| InChIKey | BUFIJLSVCRHWHL-UHFFFAOYSA-O |
| SMILES | [B-](F)(F)(F)F.CC(C)CC[NH3+] |
Computed by PubChem (NCBI)