CAS 1501856-47-8 appears in our catalog under these names: 7-Thia-2-aza-spiro[3.5]nonane 7,7-dioxide hemioxalate, 95%, 7-Thia-2-aza-spiro(3.5)nonane 7,7-dioxide oxalate(2:1), 97%, 7-Thia-2-azaspiro[3.5]nonane 7,7-dioxide oxalate(2:1), 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 25g, 100g, 5g, 250mg, 100mg, 500mg.
Bis(7lambda6-thia-2-azaspiro[3.5]nonane 7,7-dioxide);oxalic acid (CAS 1501856-47-8) is a chemical compound with the molecular formula C16H28N2O8S2 and a molecular weight of 440.5 g/mol. IUPAC name: bis(7lambda6-thia-2-azaspiro[3.5]nonane 7,7-dioxide);oxalic acid. InChIKey: DWGQHMUWZNHLRA-UHFFFAOYSA-N.
| Molecular formula | C16H28N2O8S2 |
|---|---|
| Molecular weight | 440.5 g/mol |
| IUPAC name | bis(7lambda6-thia-2-azaspiro[3.5]nonane 7,7-dioxide);oxalic acid |
| InChIKey | DWGQHMUWZNHLRA-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCC12CNC2.C1CS(=O)(=O)CCC12CNC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)