Products 1502098-02-3

CAS 1502098-02-3 is the registry number for 3-Sulfanylpyridazine-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

6-sulfanylidene-1H-pyridazine-5-carboxylic acid (CAS 1502098-02-3) is a chemical compound with the molecular formula C5H4N2O2S and a molecular weight of 156.16 g/mol. IUPAC name: 6-sulfanylidene-1H-pyridazine-5-carboxylic acid. InChIKey: SBTBYVCXHFRSMI-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4N2O2S
Molecular weight156.16 g/mol
IUPAC name6-sulfanylidene-1H-pyridazine-5-carboxylic acid
InChIKeySBTBYVCXHFRSMI-UHFFFAOYSA-N
SMILESC1=C(C(=S)NN=C1)C(=O)O

Computed by PubChem (NCBI)