Products 1502216-04-7

CAS 1502216-04-7 is the registry number for Ethyl 3-cyclopropyl-3-oxo-2-(trifluoromethyl)propanoate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Ethyl 2-(cyclopropanecarbonyl)-3,3,3-trifluoropropanoate (CAS 1502216-04-7) is a chemical compound with the molecular formula C9H11F3O3 and a molecular weight of 224.18 g/mol. IUPAC name: ethyl 2-(cyclopropanecarbonyl)-3,3,3-trifluoropropanoate. InChIKey: HSPHTIKQUJLMOO-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11F3O3
Molecular weight224.18 g/mol
IUPAC nameethyl 2-(cyclopropanecarbonyl)-3,3,3-trifluoropropanoate
InChIKeyHSPHTIKQUJLMOO-UHFFFAOYSA-N
SMILESCCOC(=O)C(C(=O)C1CC1)C(F)(F)F

Computed by PubChem (NCBI)