CAS 1502216-04-7 is the registry number for Ethyl 3-cyclopropyl-3-oxo-2-(trifluoromethyl)propanoate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Ethyl 2-(cyclopropanecarbonyl)-3,3,3-trifluoropropanoate (CAS 1502216-04-7) is a chemical compound with the molecular formula C9H11F3O3 and a molecular weight of 224.18 g/mol. IUPAC name: ethyl 2-(cyclopropanecarbonyl)-3,3,3-trifluoropropanoate. InChIKey: HSPHTIKQUJLMOO-UHFFFAOYSA-N.
| Molecular formula | C9H11F3O3 |
|---|---|
| Molecular weight | 224.18 g/mol |
| IUPAC name | ethyl 2-(cyclopropanecarbonyl)-3,3,3-trifluoropropanoate |
| InChIKey | HSPHTIKQUJLMOO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(=O)C1CC1)C(F)(F)F |
Computed by PubChem (NCBI)