Products 1502982-10-6

CAS 1502982-10-6 is the registry number for Methyl 2,2-dimethyl-3-(propylsulfanyl)propanoate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 2,2-dimethyl-3-propylsulfanylpropanoate (CAS 1502982-10-6) is a chemical compound with the molecular formula C9H18O2S and a molecular weight of 190.31 g/mol. IUPAC name: methyl 2,2-dimethyl-3-propylsulfanylpropanoate. InChIKey: LNFVHBDVRFMTTK-UHFFFAOYSA-N.

Identity
Molecular formulaC9H18O2S
Molecular weight190.31 g/mol
IUPAC namemethyl 2,2-dimethyl-3-propylsulfanylpropanoate
InChIKeyLNFVHBDVRFMTTK-UHFFFAOYSA-N
SMILESCCCSCC(C)(C)C(=O)OC

Computed by PubChem (NCBI)