CAS 1503-86-2 is the registry number for 2-Naphthyl pivalate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
Naphthalen-2-yl 2,2-dimethylpropanoate (CAS 1503-86-2) is a chemical compound with the molecular formula C15H16O2 and a molecular weight of 228.29 g/mol. IUPAC name: naphthalen-2-yl 2,2-dimethylpropanoate. InChIKey: SUGMMMOSTHSMJT-UHFFFAOYSA-N.
| Molecular formula | C15H16O2 |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | naphthalen-2-yl 2,2-dimethylpropanoate |
| InChIKey | SUGMMMOSTHSMJT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)OC1=CC2=CC=CC=C2C=C1 |
Computed by PubChem (NCBI)