CAS 150308-80-8 appears in our catalog under these names: Fmoc–Sec(Mob)–OH, Fmoc-L-Sec(Mob)-OH, Fmoc-Sec(Mob)-OH 98%, Fmoc-Sec(Mob)-OH, 98%, 98%, Fmoc-Sec(Mob)-OH, 98%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 50mg, 500mg, 5g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(4-methoxyphenyl)methylselanyl]propanoic acid (CAS 150308-80-8) is a chemical compound with the molecular formula C26H25NO5Se and a molecular weight of 510.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(4-methoxyphenyl)methylselanyl]propanoic acid. InChIKey: XCPAYIZRJRMXBI-DEOSSOPVSA-N.
| Molecular formula | C26H25NO5Se |
|---|---|
| Molecular weight | 510.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(4-methoxyphenyl)methylselanyl]propanoic acid |
| InChIKey | XCPAYIZRJRMXBI-DEOSSOPVSA-N |
| SMILES | COC1=CC=C(C=C1)C[Se]C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)