CAS 150322-01-3 appears in our catalog under these names: Fluorescein diacetate 5-maleimide, 95%, 5-(N-Maleimido)fluorescein diacetate, Fluorescein diacetate 5-u200bmaleimide, Fluorescein diacetate 5-maleimide 95% HPLC, FLUORESCEIN DIACETATE 5-MALEIMIDE SUITA&. Offered by: Combi-blocks, Biosynth, Chemat, Ambeed, Sigma-Aldrich. Available pack sizes: 100mg, 0,005g, 0,01g, 25mg, 0,025g, 200g, 10 mg, 5 mg.
[6'-acetyloxy-5-(2,5-dioxopyrrol-1-yl)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] acetate (CAS 150322-01-3) is a chemical compound with the molecular formula C28H17NO9 and a molecular weight of 511.4 g/mol. IUPAC name: [6'-acetyloxy-5-(2,5-dioxopyrrol-1-yl)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] acetate. InChIKey: WZBJWHQRQDEKOF-UHFFFAOYSA-N.
| Molecular formula | C28H17NO9 |
|---|---|
| Molecular weight | 511.4 g/mol |
| IUPAC name | [6'-acetyloxy-5-(2,5-dioxopyrrol-1-yl)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] acetate |
| InChIKey | WZBJWHQRQDEKOF-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC2=C(C=C1)C3(C4=C(C=C(C=C4)N5C(=O)C=CC5=O)C(=O)O3)C6=C(O2)C=C(C=C6)OC(=O)C |
Computed by PubChem (NCBI)