CAS 150338-77-5 is the registry number for (1S,4R)-4-(Benzyloxy)cyclopent-2-en-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,4R)-4-phenylmethoxycyclopent-2-en-1-ol (CAS 150338-77-5) is a chemical compound with the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. IUPAC name: (1S,4R)-4-phenylmethoxycyclopent-2-en-1-ol. InChIKey: YRZMGHLEACVCDU-NEPJUHHUSA-N.
| Molecular formula | C12H14O2 |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | (1S,4R)-4-phenylmethoxycyclopent-2-en-1-ol |
| InChIKey | YRZMGHLEACVCDU-NEPJUHHUSA-N |
| SMILES | C1[C@@H](C=C[C@@H]1OCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)