CAS 150360-26-2 appears in our catalog under these names: (R)-2-(4-Fluorophenyl)propanoic acid, (R)-2-(4-Fluorophenyl)propanoic acid, 98%, (R)-2-(4-fluorophenyl)propanoic acid, 96%, (R)-2-(4-Fluorophenyl)propanoic acid, 96%, 96%. Offered by: Biosynth, AmBeed, Fluorochem, Chemat. Available pack sizes: 50mg, 0,5g, 1g, 100mg, 250mg, 500mg.
(2R)-2-(4-fluorophenyl)propanoic acid (CAS 150360-26-2) is a chemical compound with the molecular formula C9H9FO2 and a molecular weight of 168.16 g/mol. IUPAC name: (2R)-2-(4-fluorophenyl)propanoic acid. InChIKey: IXSCGBODJGIJNN-ZCFIWIBFSA-N.
| Molecular formula | C9H9FO2 |
|---|---|
| Molecular weight | 168.16 g/mol |
| IUPAC name | (2R)-2-(4-fluorophenyl)propanoic acid |
| InChIKey | IXSCGBODJGIJNN-ZCFIWIBFSA-N |
| SMILES | C[C@H](C1=CC=C(C=C1)F)C(=O)O |
Computed by PubChem (NCBI)