CAS 1503695-84-8 appears in our catalog under these names: 2-(3-Methyl-1,2,4-oxadiazol-5-yl)-5-(trifluoromethyl)aniline, 95%, 2-(3-Methyl-1,2,4-oxadiazol-5-yl)-5-(trifluoromethyl)aniline. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-(3-methyl-1,2,4-oxadiazol-5-yl)-5-(trifluoromethyl)aniline (CAS 1503695-84-8) is a chemical compound with the molecular formula C10H8F3N3O and a molecular weight of 243.18 g/mol. IUPAC name: 2-(3-methyl-1,2,4-oxadiazol-5-yl)-5-(trifluoromethyl)aniline. InChIKey: XISMWECVYXUYOM-UHFFFAOYSA-N.
| Molecular formula | C10H8F3N3O |
|---|---|
| Molecular weight | 243.18 g/mol |
| IUPAC name | 2-(3-methyl-1,2,4-oxadiazol-5-yl)-5-(trifluoromethyl)aniline |
| InChIKey | XISMWECVYXUYOM-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=N1)C2=C(C=C(C=C2)C(F)(F)F)N |
Computed by PubChem (NCBI)