CAS 150374-95-1 appears in our catalog under these names: Sivelestat Sodium, >95% (HPLC), Sivelestat Sodium, Sivelestat sodium salt, (2-((4-(Pivaloyloxy)phenyl)sulfonamido)benzoyl)glycine, sodium salt, ≥98%(HPLC), ≥98%(HPLC), Sivelestat (sodium), 99.77%. Offered by: TRC, Chemat Brand, TargetMol, GLPBio, Chemat. Available pack sizes: 50mg, on request, 2mg, 10mg, 1g, 200mg, 5mg, 25mg.
Sodium 2-[[2-[[4-(2,2-dimethylpropanoyloxy)phenyl]sulfonylamino]benzoyl]amino]acetate (CAS 150374-95-1) is a chemical compound with the molecular formula C20H21N2NaO7S and a molecular weight of 456.4 g/mol. IUPAC name: sodium 2-[[2-[[4-(2,2-dimethylpropanoyloxy)phenyl]sulfonylamino]benzoyl]amino]acetate. InChIKey: ZAIFANJZUGNYCK-UHFFFAOYSA-M.
| Molecular formula | C20H21N2NaO7S |
|---|---|
| Molecular weight | 456.4 g/mol |
| IUPAC name | sodium 2-[[2-[[4-(2,2-dimethylpropanoyloxy)phenyl]sulfonylamino]benzoyl]amino]acetate |
| InChIKey | ZAIFANJZUGNYCK-UHFFFAOYSA-M |
| SMILES | CC(C)(C)C(=O)OC1=CC=C(C=C1)S(=O)(=O)NC2=CC=CC=C2C(=O)NCC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)