Products 1503816-02-1
CAS 1503816-02-1 appears in our catalog under these names: 1-tert-Butyl-1H-pyrazole-5-carboxylic acid, 1-(tert-Butyl)-1H-pyrazole-5-carboxylic acid, 98%, 1-tert-butyl-1H-pyrazole-5-carboxylic acid, 98%. Offered by: Biosynth, Fluorochem, Chemat. Available pack sizes: 2,5g, 250mg, 100mg, 500mg, 1g, 5g, 10g, 25g.
2-tert-butylpyrazole-3-carboxylic acid (CAS 1503816-02-1) is a chemical compound with the molecular formula C8H12N2O2 and a molecular weight of 168.19 g/mol. IUPAC name: 2-tert-butylpyrazole-3-carboxylic acid. InChIKey: RTXVZAHZRXZHJJ-UHFFFAOYSA-N.
| Molecular formula | C8H12N2O2 |
|---|---|
| Molecular weight | 168.19 g/mol |
| IUPAC name | 2-tert-butylpyrazole-3-carboxylic acid |
| InChIKey | RTXVZAHZRXZHJJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C(=CC=N1)C(=O)O |
Computed by PubChem (NCBI)