CAS 150494-06-7 appears in our catalog under these names: N-Nitroso Fluoxetine, N-Nitroso Fluoxetine, >95% (HPLC), N-Nitrosofluoxetine, N-Nitrosofluoxetine 0.1 mg/ml in Methanol, N–Nitroso Fluoxetine. Offered by: Chemat Brand, TRC, Mikromol, TargetMol, GLPBio. Available pack sizes: on request, 250mg, 500mg, 50mg, 25mg, 1ml, 10mg, 1mg.
N-methyl-N-[3-phenyl-3-[4-(trifluoromethyl)phenoxy]propyl]nitrous amide (CAS 150494-06-7) is a chemical compound with the molecular formula C17H17F3N2O2 and a molecular weight of 338.32 g/mol. IUPAC name: N-methyl-N-[3-phenyl-3-[4-(trifluoromethyl)phenoxy]propyl]nitrous amide. InChIKey: AMFPKCLSNGLBNR-UHFFFAOYSA-N.
| Molecular formula | C17H17F3N2O2 |
|---|---|
| Molecular weight | 338.32 g/mol |
| IUPAC name | N-methyl-N-[3-phenyl-3-[4-(trifluoromethyl)phenoxy]propyl]nitrous amide |
| InChIKey | AMFPKCLSNGLBNR-UHFFFAOYSA-N |
| SMILES | CN(CCC(C1=CC=CC=C1)OC2=CC=C(C=C2)C(F)(F)F)N=O |
Computed by PubChem (NCBI)