CAS 1505050-02-1 appears in our catalog under these names: 1-(3-Aminophenyl)-1,3,3-trimethylurea, 1-(3-Aminophenyl)-1,3,3-trimethylurea, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
1-(3-aminophenyl)-1,3,3-trimethylurea (CAS 1505050-02-1) is a chemical compound with the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. IUPAC name: 1-(3-aminophenyl)-1,3,3-trimethylurea. InChIKey: KVRGVFCXVNNRQI-UHFFFAOYSA-N.
| Molecular formula | C10H15N3O |
|---|---|
| Molecular weight | 193.25 g/mol |
| IUPAC name | 1-(3-aminophenyl)-1,3,3-trimethylurea |
| InChIKey | KVRGVFCXVNNRQI-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)N(C)C1=CC=CC(=C1)N |
Computed by PubChem (NCBI)