Products 1505056-54-1

CAS 1505056-54-1 appears in our catalog under these names: N-Methyl-N-(2,2,2-Trifluoroethyl)carbamoyl Chloride, N-Methyl-N-(2,2,2-trifluoroethyl)carbamoyl chloride, 95%. Offered by: TRC, AmBeed. Available pack sizes: 2,5g, 1g.

Structural formula: {0} (CAS {1})

N-methyl-N-(2,2,2-trifluoroethyl)carbamoyl chloride (CAS 1505056-54-1) is a chemical compound with the molecular formula C4H5ClF3NO and a molecular weight of 175.54 g/mol. IUPAC name: N-methyl-N-(2,2,2-trifluoroethyl)carbamoyl chloride. InChIKey: QOKZVYAZXUDYIX-UHFFFAOYSA-N.

Identity
Molecular formulaC4H5ClF3NO
Molecular weight175.54 g/mol
IUPAC nameN-methyl-N-(2,2,2-trifluoroethyl)carbamoyl chloride
InChIKeyQOKZVYAZXUDYIX-UHFFFAOYSA-N
SMILESCN(CC(F)(F)F)C(=O)Cl

Computed by PubChem (NCBI)