CAS 1505334-73-5 is the registry number for 1-(6-bromo-2-fluoro-3-methylphenyl)ethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
1-(6-bromo-2-fluoro-3-methylphenyl)ethanol (CAS 1505334-73-5) is a chemical compound with the molecular formula C9H10BrFO and a molecular weight of 233.08 g/mol. IUPAC name: 1-(6-bromo-2-fluoro-3-methylphenyl)ethanol. InChIKey: JDYCMAIWZBZBEJ-UHFFFAOYSA-N.
| Molecular formula | C9H10BrFO |
|---|---|
| Molecular weight | 233.08 g/mol |
| IUPAC name | 1-(6-bromo-2-fluoro-3-methylphenyl)ethanol |
| InChIKey | JDYCMAIWZBZBEJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)Br)C(C)O)F |
Computed by PubChem (NCBI)