CAS 1505403-97-3 appears in our catalog under these names: 2-(2-Methoxypropan-2-yl)-4-methyl-1,3-thiazole-5-carboxylic acid, 95%, 2-(2-Methoxypropan-2-yl)-4-methyl-1,3-thiazole-5-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-(2-methoxypropan-2-yl)-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 1505403-97-3) is a chemical compound with the molecular formula C9H13NO3S and a molecular weight of 215.27 g/mol. IUPAC name: 2-(2-methoxypropan-2-yl)-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: KWOQUQGRWWYXJV-UHFFFAOYSA-N.
| Molecular formula | C9H13NO3S |
|---|---|
| Molecular weight | 215.27 g/mol |
| IUPAC name | 2-(2-methoxypropan-2-yl)-4-methyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | KWOQUQGRWWYXJV-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C(C)(C)OC)C(=O)O |
Computed by PubChem (NCBI)