Products 1505455-50-4
CAS 1505455-50-4 is the registry number for 1-(5-Fluoro-2,3,3-trimethylindolin-1-yl)ethanone, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g.
1-(5-fluoro-2,3,3-trimethyl-2H-indol-1-yl)ethanone (CAS 1505455-50-4) is a chemical compound with the molecular formula C13H16FNO and a molecular weight of 221.27 g/mol. IUPAC name: 1-(5-fluoro-2,3,3-trimethyl-2H-indol-1-yl)ethanone. InChIKey: VAWPMMZSERYTCV-UHFFFAOYSA-N.
| Molecular formula | C13H16FNO |
|---|---|
| Molecular weight | 221.27 g/mol |
| IUPAC name | 1-(5-fluoro-2,3,3-trimethyl-2H-indol-1-yl)ethanone |
| InChIKey | VAWPMMZSERYTCV-UHFFFAOYSA-N |
| SMILES | CC1C(C2=C(N1C(=O)C)C=CC(=C2)F)(C)C |
Computed by PubChem (NCBI)