Products 1506744-53-1
CAS 1506744-53-1 is the registry number for 5-Amino-1-(4-chloro-3-fluorophenyl)-1H-pyrazole-4-carbonitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-amino-1-(4-chloro-3-fluorophenyl)pyrazole-4-carbonitrile (CAS 1506744-53-1) is a chemical compound with the molecular formula C10H6ClFN4 and a molecular weight of 236.63 g/mol. IUPAC name: 5-amino-1-(4-chloro-3-fluorophenyl)pyrazole-4-carbonitrile. InChIKey: FHUVKJXCHYDELH-UHFFFAOYSA-N.
| Molecular formula | C10H6ClFN4 |
|---|---|
| Molecular weight | 236.63 g/mol |
| IUPAC name | 5-amino-1-(4-chloro-3-fluorophenyl)pyrazole-4-carbonitrile |
| InChIKey | FHUVKJXCHYDELH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N2C(=C(C=N2)C#N)N)F)Cl |
Computed by PubChem (NCBI)