CAS 1506942-35-3 appears in our catalog under these names: Flupirtine Maleate Impurity E, 6-Amino-2-(4-fluorobenzyl)amino-3-nitro-pyridine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 5g.
2-N-[(4-fluorophenyl)methyl]-3-nitropyridine-2,6-diamine (CAS 1506942-35-3) is a chemical compound with the molecular formula C12H11FN4O2 and a molecular weight of 262.24 g/mol. IUPAC name: 2-N-[(4-fluorophenyl)methyl]-3-nitropyridine-2,6-diamine. InChIKey: ZXNXUYPTGXNDRS-UHFFFAOYSA-N.
| Molecular formula | C12H11FN4O2 |
|---|---|
| Molecular weight | 262.24 g/mol |
| IUPAC name | 2-N-[(4-fluorophenyl)methyl]-3-nitropyridine-2,6-diamine |
| InChIKey | ZXNXUYPTGXNDRS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CNC2=C(C=CC(=N2)N)[N+](=O)[O-])F |
Computed by PubChem (NCBI)