CAS 150698-82-1 is the registry number for 2,2,2-Trifluoro-1-(4-(trifluoromethoxy)phenyl)ethan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2,2-trifluoro-1-[4-(trifluoromethoxy)phenyl]ethanol (CAS 150698-82-1) is a chemical compound with the molecular formula C9H6F6O2 and a molecular weight of 260.13 g/mol. IUPAC name: 2,2,2-trifluoro-1-[4-(trifluoromethoxy)phenyl]ethanol. InChIKey: JKYTUWKXPZTBDF-UHFFFAOYSA-N.
| Molecular formula | C9H6F6O2 |
|---|---|
| Molecular weight | 260.13 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-[4-(trifluoromethoxy)phenyl]ethanol |
| InChIKey | JKYTUWKXPZTBDF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(F)(F)F)O)OC(F)(F)F |
Computed by PubChem (NCBI)