CAS 150736-72-4 appears in our catalog under these names: N–Boc–(S)–(–)–2–amino–1–butanol, N-Boc-(S)-(ˆ’)-2-amino-1-butanol, (S)-tert-Butyl (1-hydroxybutan-2-yl)carbamate, 97%. Offered by: GLPBio, Biosynth, Fluorochem. Available pack sizes: 100g, 25g, 5g, 10g.
Tert-butyl N-[(2S)-1-hydroxybutan-2-yl]carbamate (CAS 150736-72-4) is a chemical compound with the molecular formula C9H19NO3 and a molecular weight of 189.25 g/mol. IUPAC name: tert-butyl N-[(2S)-1-hydroxybutan-2-yl]carbamate. InChIKey: LQRGWGOFPUXNOV-ZETCQYMHSA-N.
| Molecular formula | C9H19NO3 |
|---|---|
| Molecular weight | 189.25 g/mol |
| IUPAC name | tert-butyl N-[(2S)-1-hydroxybutan-2-yl]carbamate |
| InChIKey | LQRGWGOFPUXNOV-ZETCQYMHSA-N |
| SMILES | CC[C@@H](CO)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)