CAS 150784-74-0 appears in our catalog under these names: N1-(4-(pyridin-3-yl)pyrimidin-2-yl)benzene-1,4-diamine, 98%, 98%, N1-(4-(pyridin-3-yl)pyrimidin-2-yl)benzene-1,4-diamine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 50mg, 500mg.
4-N-(4-pyridin-3-ylpyrimidin-2-yl)benzene-1,4-diamine (CAS 150784-74-0) is a chemical compound with the molecular formula C15H13N5 and a molecular weight of 263.30 g/mol. IUPAC name: 4-N-(4-pyridin-3-ylpyrimidin-2-yl)benzene-1,4-diamine. InChIKey: PIBQBVVEKOXUHV-UHFFFAOYSA-N.
| Molecular formula | C15H13N5 |
|---|---|
| Molecular weight | 263.30 g/mol |
| IUPAC name | 4-N-(4-pyridin-3-ylpyrimidin-2-yl)benzene-1,4-diamine |
| InChIKey | PIBQBVVEKOXUHV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=NC(=NC=C2)NC3=CC=C(C=C3)N |
Computed by PubChem (NCBI)