CAS 1508022-28-3 appears in our catalog under these names: Diphenyl(spiro[fluorene-9,9'-xanthen]-4'-yl)phosphine oxide, 97%, Poly(2,5-bisoctyloxy)-1,4-phenylenevinylene). Offered by: Chemat Brand, Lumtec. Available pack sizes: on request.
4'-diphenylphosphorylspiro[fluorene-9,9'-xanthene] (CAS 1508022-28-3) is a chemical compound with the molecular formula C37H25O2P and a molecular weight of 532.6 g/mol. IUPAC name: 4'-diphenylphosphorylspiro[fluorene-9,9'-xanthene]. InChIKey: WHIXGNBIPKLGAV-UHFFFAOYSA-N.
| Molecular formula | C37H25O2P |
|---|---|
| Molecular weight | 532.6 g/mol |
| IUPAC name | 4'-diphenylphosphorylspiro[fluorene-9,9'-xanthene] |
| InChIKey | WHIXGNBIPKLGAV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(=O)(C2=CC=CC=C2)C3=CC=CC4=C3OC5=CC=CC=C5C46C7=CC=CC=C7C8=CC=CC=C68 |
Computed by PubChem (NCBI)