CAS 1508066-38-3 is the registry number for 2-Bromo-4-fluoro-1,3-benzoxazole. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-bromo-4-fluoro-1,3-benzoxazole (CAS 1508066-38-3) is a chemical compound with the molecular formula C7H3BrFNO and a molecular weight of 216.01 g/mol. IUPAC name: 2-bromo-4-fluoro-1,3-benzoxazole. InChIKey: WVMSAFFWGTYFDC-UHFFFAOYSA-N.
| Molecular formula | C7H3BrFNO |
|---|---|
| Molecular weight | 216.01 g/mol |
| IUPAC name | 2-bromo-4-fluoro-1,3-benzoxazole |
| InChIKey | WVMSAFFWGTYFDC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)F)N=C(O2)Br |
Computed by PubChem (NCBI)