Products 1508154-06-0

CAS 1508154-06-0 is the registry number for 2-Cyclopropyl-4-methylpentanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-cyclopropyl-4-methylpentanoic acid (CAS 1508154-06-0) is a chemical compound with the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. IUPAC name: 2-cyclopropyl-4-methylpentanoic acid. InChIKey: PSGARCCCISVQMX-UHFFFAOYSA-N.

Identity
Molecular formulaC9H16O2
Molecular weight156.22 g/mol
IUPAC name2-cyclopropyl-4-methylpentanoic acid
InChIKeyPSGARCCCISVQMX-UHFFFAOYSA-N
SMILESCC(C)CC(C1CC1)C(=O)O

Computed by PubChem (NCBI)