Products 150829-29-1
CAS 150829-29-1 is the registry number for Fosdenopterin. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
Precursor Z hydrate is a linear-fused organic heterotetracyclic compound consisting of a [1,3,2]dioxaphosphinane fused to a pyran ring which is in turn fused to a pteridine ring system. Molybdenum cofactor biosynthesis intermediate. Dehydrated derivative known as precursor Z. It has a role as an Escherichia coli metabolite. It is an organonitrogen heterocyclic compound, an oxacycle, an organic heterotetracyclic compound and a ketone hydrate.
Source: ChEBI
| Molecular formula | C10H14N5O8P |
|---|---|
| Molecular weight | 363.22 g/mol |
| IUPAC name | (1R,10R,12S,17R)-5-amino-11,11,14-trihydroxy-14-oxo-13,15,18-trioxa-2,4,6,9-tetraza-14lambda5-phosphatetracyclo[8.8.0.03,8.012,17]octadeca-3(8),4-dien-7-one |
| InChIKey | CZAKJJUNKNPTTO-AJFJRRQVSA-N |
| SMILES | C1[C@@H]2[C@@H](C([C@H]3[C@@H](O2)NC4=C(N3)C(=O)NC(=N4)N)(O)O)OP(=O)(O1)O |
Computed by PubChem (NCBI)