Products 1508841-86-8

CAS 1508841-86-8 is the registry number for (2-Bromoethyl)-ethylcarbamic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Tert-butyl N-(2-bromoethyl)-N-ethylcarbamate (CAS 1508841-86-8) is a chemical compound with the molecular formula C9H18BrNO2 and a molecular weight of 252.15 g/mol. IUPAC name: tert-butyl N-(2-bromoethyl)-N-ethylcarbamate. InChIKey: AIPLAHZRPDQTLJ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H18BrNO2
Molecular weight252.15 g/mol
IUPAC nametert-butyl N-(2-bromoethyl)-N-ethylcarbamate
InChIKeyAIPLAHZRPDQTLJ-UHFFFAOYSA-N
SMILESCCN(CCBr)C(=O)OC(C)(C)C

Computed by PubChem (NCBI)