CAS 1509056-86-3 is the registry number for 1-(3-Amino-4-methylphenyl)-3,3-dimethylurea. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(3-amino-4-methylphenyl)-1,1-dimethylurea (CAS 1509056-86-3) is a chemical compound with the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. IUPAC name: 3-(3-amino-4-methylphenyl)-1,1-dimethylurea. InChIKey: IIKYZXGNETYELK-UHFFFAOYSA-N.
| Molecular formula | C10H15N3O |
|---|---|
| Molecular weight | 193.25 g/mol |
| IUPAC name | 3-(3-amino-4-methylphenyl)-1,1-dimethylurea |
| InChIKey | IIKYZXGNETYELK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)N(C)C)N |
Computed by PubChem (NCBI)