Products 1509079-55-3
CAS 1509079-55-3 is the registry number for 4-(2-Bromophenyl)-1-methyl-1H-pyrazole, >95%, >95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
4-(2-bromophenyl)-1-methylpyrazole (CAS 1509079-55-3) is a chemical compound with the molecular formula C10H9BrN2 and a molecular weight of 237.10 g/mol. IUPAC name: 4-(2-bromophenyl)-1-methylpyrazole. InChIKey: FPPFKIJTNXNQPC-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2 |
|---|---|
| Molecular weight | 237.10 g/mol |
| IUPAC name | 4-(2-bromophenyl)-1-methylpyrazole |
| InChIKey | FPPFKIJTNXNQPC-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)C2=CC=CC=C2Br |
Computed by PubChem (NCBI)