CAS 1509170-86-8 is the registry number for 3-(7-Bromo-2,3-dihydropyrido[2,3-b]pyrazin-4(1H)-yl)tetrahydrothiophene 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(7-bromo-2,3-dihydro-1H-pyrido[2,3-b]pyrazin-4-yl)thiolane 1,1-dioxide (CAS 1509170-86-8) is a chemical compound with the molecular formula C11H14BrN3O2S and a molecular weight of 332.22 g/mol. IUPAC name: 3-(7-bromo-2,3-dihydro-1H-pyrido[2,3-b]pyrazin-4-yl)thiolane 1,1-dioxide. InChIKey: SHZVDRXCJHDANO-UHFFFAOYSA-N.
| Molecular formula | C11H14BrN3O2S |
|---|---|
| Molecular weight | 332.22 g/mol |
| IUPAC name | 3-(7-bromo-2,3-dihydro-1H-pyrido[2,3-b]pyrazin-4-yl)thiolane 1,1-dioxide |
| InChIKey | SHZVDRXCJHDANO-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1N2CCNC3=C2N=CC(=C3)Br |
Computed by PubChem (NCBI)