CAS 2721901-67-1 is the registry number for 3-(5-Bromo-3-methyl-2,3-dihydro-1H-pyrazolo[3,4-b]pyridin-1-yl)tetrahydrothiophene 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(5-bromo-3-methyl-2,3-dihydropyrazolo[3,4-b]pyridin-1-yl)thiolane 1,1-dioxide (CAS 2721901-67-1) is a chemical compound with the molecular formula C11H14BrN3O2S and a molecular weight of 332.22 g/mol. IUPAC name: 3-(5-bromo-3-methyl-2,3-dihydropyrazolo[3,4-b]pyridin-1-yl)thiolane 1,1-dioxide. InChIKey: DYKVGOAXUFLUEO-UHFFFAOYSA-N.
| Molecular formula | C11H14BrN3O2S |
|---|---|
| Molecular weight | 332.22 g/mol |
| IUPAC name | 3-(5-bromo-3-methyl-2,3-dihydropyrazolo[3,4-b]pyridin-1-yl)thiolane 1,1-dioxide |
| InChIKey | DYKVGOAXUFLUEO-UHFFFAOYSA-N |
| SMILES | CC1C2=C(N=CC(=C2)Br)N(N1)C3CCS(=O)(=O)C3 |
Computed by PubChem (NCBI)