Products 1509390-72-0
CAS 1509390-72-0 is the registry number for 4-(1,1-Difluoro-2-hydroxypropan-2-yl)benzonitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(1,1-difluoro-2-hydroxypropan-2-yl)benzonitrile (CAS 1509390-72-0) is a chemical compound with the molecular formula C10H9F2NO and a molecular weight of 197.18 g/mol. IUPAC name: 4-(1,1-difluoro-2-hydroxypropan-2-yl)benzonitrile. InChIKey: UALBSNWCYMYVOG-UHFFFAOYSA-N.
| Molecular formula | C10H9F2NO |
|---|---|
| Molecular weight | 197.18 g/mol |
| IUPAC name | 4-(1,1-difluoro-2-hydroxypropan-2-yl)benzonitrile |
| InChIKey | UALBSNWCYMYVOG-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)C#N)(C(F)F)O |
Computed by PubChem (NCBI)