Products 1509504-29-3
CAS 1509504-29-3 appears in our catalog under these names: Methyl 2,3-dichloro-5-iodobenzoate, Methyl 2,3-dichloro-5-iodobenzoate, 95%. Offered by: Biosynth, Ambeed, BLDpharm. Available pack sizes: 0,5g, 50mg, 250mg, 1g, 100mg.
Methyl 2,3-dichloro-5-iodobenzoate (CAS 1509504-29-3) is a chemical compound with the molecular formula C8H5Cl2IO2 and a molecular weight of 330.93 g/mol. IUPAC name: methyl 2,3-dichloro-5-iodobenzoate. InChIKey: AEEBREVLBQVNSB-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2IO2 |
|---|---|
| Molecular weight | 330.93 g/mol |
| IUPAC name | methyl 2,3-dichloro-5-iodobenzoate |
| InChIKey | AEEBREVLBQVNSB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC(=C1)I)Cl)Cl |
Computed by PubChem (NCBI)